Organometallic Compounds
Filtered Search Results
Dimethyloctadecyl[3-(trimethoxysilyl)propyl]ammonium chloride, 60% in methanol
CAS: 27668-52-6 Molecular Formula: C26H58ClNO3Si Molecular Weight (g/mol): 496.29 MDL Number: MFCD00054224 InChI Key: WSFMFXQNYPNYGG-UHFFFAOYSA-M Synonym: quat-silsesquioxane,dmoap,dow corning 5700,caswell no. 892b,dimethyloctadecyl 3-trimethoxysilyl propyl ammonium chloride,unii-iq36o85wq4,n,n-dimethyl-n-3-trimethoxysilyl propyl octadecan-1-aminium chloride,epa pesticide chemical code 107401,3-trimethoxysilyl propyl dimethyl octadecyl ammonium chloride,3-trimethoxysilyl propyldimethyloctadecylammonium PubChem CID: 62827 IUPAC Name: dimethyl-octadecyl-(3-trimethoxysilylpropyl)azanium;chloride SMILES: [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CCC[Si](OC)(OC)OC
| PubChem CID | 62827 |
|---|---|
| CAS | 27668-52-6 |
| Molecular Weight (g/mol) | 496.29 |
| MDL Number | MFCD00054224 |
| SMILES | [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CCC[Si](OC)(OC)OC |
| Synonym | quat-silsesquioxane,dmoap,dow corning 5700,caswell no. 892b,dimethyloctadecyl 3-trimethoxysilyl propyl ammonium chloride,unii-iq36o85wq4,n,n-dimethyl-n-3-trimethoxysilyl propyl octadecan-1-aminium chloride,epa pesticide chemical code 107401,3-trimethoxysilyl propyl dimethyl octadecyl ammonium chloride,3-trimethoxysilyl propyldimethyloctadecylammonium |
| IUPAC Name | dimethyl-octadecyl-(3-trimethoxysilylpropyl)azanium;chloride |
| InChI Key | WSFMFXQNYPNYGG-UHFFFAOYSA-M |
| Molecular Formula | C26H58ClNO3Si |
Triphenyltin chloride, 95%
CAS: 639-58-7 Molecular Formula: C18H17ClSn Molecular Weight (g/mol): 387.49 MDL Number: MFCD00000519 InChI Key: ZDYYCRIXXMWWQC-UHFFFAOYSA-N Synonym: triphenyltin chloride,fentin chloride,chlorotriphenyltin,triphenylchlorotin,stannane, chlorotriphenyl,brestanol,tptc,triphenylchlorostannane,aquatin,tinmate PubChem CID: 12540 ChEBI: CHEBI:35036 IUPAC Name: chloro(triphenyl)stannane SMILES: Cl.C1=CC=C(C=C1)[SnH](C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 12540 |
|---|---|
| CAS | 639-58-7 |
| Molecular Weight (g/mol) | 387.49 |
| ChEBI | CHEBI:35036 |
| MDL Number | MFCD00000519 |
| SMILES | Cl.C1=CC=C(C=C1)[SnH](C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenyltin chloride,fentin chloride,chlorotriphenyltin,triphenylchlorotin,stannane, chlorotriphenyl,brestanol,tptc,triphenylchlorostannane,aquatin,tinmate |
| IUPAC Name | chloro(triphenyl)stannane |
| InChI Key | ZDYYCRIXXMWWQC-UHFFFAOYSA-N |
| Molecular Formula | C18H17ClSn |
Triethoxy-n-octylsilane 97.0+%, TCI America™
CAS: 2943-75-1 Molecular Formula: C14H32O3Si Molecular Weight (g/mol): 276.49 MDL Number: MFCD00039883 InChI Key: MSRJTTSHWYDFIU-UHFFFAOYSA-N Synonym: n-octyltriethoxysilane,octyltriethoxysilane,triethoxy octyl silane,silane, triethoxyoctyl,dynasylan octeo,octyl triethoxy silane,prosil 9202,silquest a 137,prosil 9234,a 137 coupling agent PubChem CID: 76262 IUPAC Name: triethoxy(octyl)silane SMILES: CCCCCCCC[Si](OCC)(OCC)OCC
| PubChem CID | 76262 |
|---|---|
| CAS | 2943-75-1 |
| Molecular Weight (g/mol) | 276.49 |
| MDL Number | MFCD00039883 |
| SMILES | CCCCCCCC[Si](OCC)(OCC)OCC |
| Synonym | n-octyltriethoxysilane,octyltriethoxysilane,triethoxy octyl silane,silane, triethoxyoctyl,dynasylan octeo,octyl triethoxy silane,prosil 9202,silquest a 137,prosil 9234,a 137 coupling agent |
| IUPAC Name | triethoxy(octyl)silane |
| InChI Key | MSRJTTSHWYDFIU-UHFFFAOYSA-N |
| Molecular Formula | C14H32O3Si |
Diphenyl ditelluride, 97%
CAS: 32294-60-3 Molecular Formula: C12H10Te2 Molecular Weight (g/mol): 409.27 MDL Number: MFCD00192106 InChI Key: VRLFOXMNTSYGMX-UHFFFAOYSA-N Synonym: diphenyl ditelluride,phenyl ditelluride,ditelluride, diphenyl,diphenylditelluride,ditelluride, diephenyl,phenylditellanyl benzene,diphenylditellane,diphenyl pertelluride,acmc-209hsa,1,2-diphenylditellane # PubChem CID: 100657 IUPAC Name: (phenylditellanyl)benzene SMILES: C1=CC=C(C=C1)[Te][Te]C2=CC=CC=C2
| PubChem CID | 100657 |
|---|---|
| CAS | 32294-60-3 |
| Molecular Weight (g/mol) | 409.27 |
| MDL Number | MFCD00192106 |
| SMILES | C1=CC=C(C=C1)[Te][Te]C2=CC=CC=C2 |
| Synonym | diphenyl ditelluride,phenyl ditelluride,ditelluride, diphenyl,diphenylditelluride,ditelluride, diephenyl,phenylditellanyl benzene,diphenylditellane,diphenyl pertelluride,acmc-209hsa,1,2-diphenylditellane # |
| IUPAC Name | (phenylditellanyl)benzene |
| InChI Key | VRLFOXMNTSYGMX-UHFFFAOYSA-N |
| Molecular Formula | C12H10Te2 |
tert-Butylchlorodimethylsilane, 98%
CAS: 18162-48-6 Molecular Formula: C6H15ClSi Molecular Weight (g/mol): 150.73 MDL Number: MFCD00000501 InChI Key: BCNZYOJHNLTNEZ-UHFFFAOYSA-N Synonym: tert-butyldimethylsilyl chloride,tert-butyldimethylchlorosilane,t-butyldimethylchlorosilane,tert-butylchlorodimethylsilane,tbdms chloride,tert-butyl chloro dimethylsilane,chloro-tert-butyldimethylsilane,silane, chloro 1,1-dimethylethyl dimethyl,tbscl,t-butyldimethylsilyl chloride PubChem CID: 28928 ChEBI: CHEBI:85071 IUPAC Name: tert-butyl-chloro-dimethylsilane SMILES: CC(C)(C)[Si](C)(C)Cl
| PubChem CID | 28928 |
|---|---|
| CAS | 18162-48-6 |
| Molecular Weight (g/mol) | 150.73 |
| ChEBI | CHEBI:85071 |
| MDL Number | MFCD00000501 |
| SMILES | CC(C)(C)[Si](C)(C)Cl |
| Synonym | tert-butyldimethylsilyl chloride,tert-butyldimethylchlorosilane,t-butyldimethylchlorosilane,tert-butylchlorodimethylsilane,tbdms chloride,tert-butyl chloro dimethylsilane,chloro-tert-butyldimethylsilane,silane, chloro 1,1-dimethylethyl dimethyl,tbscl,t-butyldimethylsilyl chloride |
| IUPAC Name | tert-butyl-chloro-dimethylsilane |
| InChI Key | BCNZYOJHNLTNEZ-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClSi |
Diisobutylaluminium hydride, 1M solution in hexane, AcroSeal™
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| Linear Formula | [(CH3)2CHCH2]2AlH |
|---|---|
| Molecular Weight (g/mol) | 142.22 |
| Physical Form | Solution |
| Chemical Name or Material | Diisobutylaluminium hydride |
| Merck Index | 15, 3212 |
| Density | 0.7010g/mL |
| Name Note | 1M Solution in Hexane |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| CAS | 110-54-3 |
| Health Hazard 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective g |
| MDL Number | MFCD00008928 |
| Health Hazard 2 | GHS H Statement May be fatal if swallowed and enters airways. Toxic to aquatic life with long lasting effects. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. May cause damage to organs through p |
| Solubility Information | Solubility in water: reacts |
| Flash Point | −23°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | DIBAL-H |
| Beilstein | 04, IV, 4400 |
| Molecular Formula | C8H19Al |
| EINECS Number | 214-729-9 |
| Formula Weight | 142.22 |
| Specific Gravity | 0.701 |
| Melting Point | -70.0°C |
Butyltrichlorosilane, 99%
CAS: 7521-80-4 Molecular Formula: C4H9Cl3Si Molecular Weight (g/mol): 191.56 InChI Key: FQEKAFQSVPLXON-UHFFFAOYSA-N Synonym: silane, butyltrichloro,n-butyltrichlorosilane,trichlorobutylsilane,unii-zq9o7lyo00,zq9o7lyo00,butylsilicon trichloride,n-butyl trichlorosilane,butyl trichlorosilane,hsdb 283,butyl-trichlorosilane PubChem CID: 24142 IUPAC Name: butyl(trichloro)silane SMILES: CCCC[Si](Cl)(Cl)Cl
| PubChem CID | 24142 |
|---|---|
| CAS | 7521-80-4 |
| Molecular Weight (g/mol) | 191.56 |
| SMILES | CCCC[Si](Cl)(Cl)Cl |
| Synonym | silane, butyltrichloro,n-butyltrichlorosilane,trichlorobutylsilane,unii-zq9o7lyo00,zq9o7lyo00,butylsilicon trichloride,n-butyl trichlorosilane,butyl trichlorosilane,hsdb 283,butyl-trichlorosilane |
| IUPAC Name | butyl(trichloro)silane |
| InChI Key | FQEKAFQSVPLXON-UHFFFAOYSA-N |
| Molecular Formula | C4H9Cl3Si |
N,N-Diethyl-1,1,1-trimethylsilylamine, 98+%
CAS: 996-50-9 Molecular Formula: C7H19NSi Molecular Weight (g/mol): 145.32 MDL Number: MFCD00009040 InChI Key: JOOMLFKONHCLCJ-UHFFFAOYSA-N Synonym: n,n-diethyl-1,1,1-trimethylsilylamine,trimethylsilyldiethylamine,diethylaminotrimethylsilane,n,n-diethyltrimethylsilylamine,n,n-diethyl-1,1,1-trimethylsilanamine,n,n-diethylaminotrimethylsilane,diethyl trimethylsilyl amine,n-trimethylsilyldiethylamine,diethylamino trimethylsilane,n-trimethylsilyl diethylamine PubChem CID: 70454 ChEBI: CHEBI:85070 IUPAC Name: N-ethyl-N-trimethylsilylethanamine SMILES: CCN(CC)[Si](C)(C)C
| PubChem CID | 70454 |
|---|---|
| CAS | 996-50-9 |
| Molecular Weight (g/mol) | 145.32 |
| ChEBI | CHEBI:85070 |
| MDL Number | MFCD00009040 |
| SMILES | CCN(CC)[Si](C)(C)C |
| Synonym | n,n-diethyl-1,1,1-trimethylsilylamine,trimethylsilyldiethylamine,diethylaminotrimethylsilane,n,n-diethyltrimethylsilylamine,n,n-diethyl-1,1,1-trimethylsilanamine,n,n-diethylaminotrimethylsilane,diethyl trimethylsilyl amine,n-trimethylsilyldiethylamine,diethylamino trimethylsilane,n-trimethylsilyl diethylamine |
| IUPAC Name | N-ethyl-N-trimethylsilylethanamine |
| InChI Key | JOOMLFKONHCLCJ-UHFFFAOYSA-N |
| Molecular Formula | C7H19NSi |
Methyltriethoxysilane, 98+%
CAS: 2031-67-6 Molecular Formula: C7H18O3Si Molecular Weight (g/mol): 178.30 MDL Number: MFCD00009066 InChI Key: CPUDPFPXCZDNGI-UHFFFAOYSA-N Synonym: methyltriethoxysilane,triethoxy methyl silane,methyl triethoxysilane,silane, triethoxymethyl,triethoxysilylmethane,union carbide a-162,ici-ep 5850,silane, methyltriethoxy,methaneorthosiliconic acid, triethyl ester,mtes PubChem CID: 16241 IUPAC Name: triethoxy(methyl)silane SMILES: CCO[Si](C)(OCC)OCC
| PubChem CID | 16241 |
|---|---|
| CAS | 2031-67-6 |
| Molecular Weight (g/mol) | 178.30 |
| MDL Number | MFCD00009066 |
| SMILES | CCO[Si](C)(OCC)OCC |
| Synonym | methyltriethoxysilane,triethoxy methyl silane,methyl triethoxysilane,silane, triethoxymethyl,triethoxysilylmethane,union carbide a-162,ici-ep 5850,silane, methyltriethoxy,methaneorthosiliconic acid, triethyl ester,mtes |
| IUPAC Name | triethoxy(methyl)silane |
| InChI Key | CPUDPFPXCZDNGI-UHFFFAOYSA-N |
| Molecular Formula | C7H18O3Si |
Copper(II) oxalate hemihydrate, 98%
CAS: 5893-66-3 Molecular Formula: C4H8Cu2O10 Molecular Weight (g/mol): 343.19 MDL Number: MFCD00150451 InChI Key: NNZNHNMQOYUANB-UHFFFAOYSA-N Synonym: cupric oxalate,copper oxalate hemihydrate PubChem CID: 122130000 IUPAC Name: copper;oxalic acid;hydrate SMILES: O.O.[Cu].[Cu].OC(=O)C(O)=O.OC(=O)C(O)=O
| PubChem CID | 122130000 |
|---|---|
| CAS | 5893-66-3 |
| Molecular Weight (g/mol) | 343.19 |
| MDL Number | MFCD00150451 |
| SMILES | O.O.[Cu].[Cu].OC(=O)C(O)=O.OC(=O)C(O)=O |
| Synonym | cupric oxalate,copper oxalate hemihydrate |
| IUPAC Name | copper;oxalic acid;hydrate |
| InChI Key | NNZNHNMQOYUANB-UHFFFAOYSA-N |
| Molecular Formula | C4H8Cu2O10 |
1-(Trimethylsilyl)imidazole, 97%
CAS: 18156-74-6 Molecular Formula: C6H12N2Si Molecular Weight (g/mol): 140.26 MDL Number: MFCD00005280 InChI Key: YKFRUJSEPGHZFJ-UHFFFAOYSA-N Synonym: n-trimethylsilyl imidazole,1-trimethylsilyl imidazole,1-trimethylsilyl-1h-imidazole,tsim,1h-imidazole, 1-trimethylsilyl,n-trimethylsilylimidazole,trimethylsilyl imidazole,1-trimethylsilylimidazole,n-trimethylsilyl imidazol,imidazole, 1-trimethylsilyl PubChem CID: 28925 ChEBI: CHEBI:85063 IUPAC Name: imidazol-1-yl(trimethyl)silane SMILES: C[Si](C)(C)N1C=CN=C1
| PubChem CID | 28925 |
|---|---|
| CAS | 18156-74-6 |
| Molecular Weight (g/mol) | 140.26 |
| ChEBI | CHEBI:85063 |
| MDL Number | MFCD00005280 |
| SMILES | C[Si](C)(C)N1C=CN=C1 |
| Synonym | n-trimethylsilyl imidazole,1-trimethylsilyl imidazole,1-trimethylsilyl-1h-imidazole,tsim,1h-imidazole, 1-trimethylsilyl,n-trimethylsilylimidazole,trimethylsilyl imidazole,1-trimethylsilylimidazole,n-trimethylsilyl imidazol,imidazole, 1-trimethylsilyl |
| IUPAC Name | imidazol-1-yl(trimethyl)silane |
| InChI Key | YKFRUJSEPGHZFJ-UHFFFAOYSA-N |
| Molecular Formula | C6H12N2Si |
3-Glycidyloxypropyltrimethoxysilane 97.0+%, TCI America™
CAS: 2530-83-8 Molecular Formula: C9H20O5Si Molecular Weight (g/mol): 236.339 MDL Number: MFCD00005144 InChI Key: BPSIOYPQMFLKFR-UHFFFAOYSA-N Synonym: 3-glycidoxypropyltrimethoxysilane,3-glycidoxypropyl trimethoxysilane,glymo,silicone kbm 403,silane a 187,union carbide a-187,silan a 187,silane z 6040,silane-y-4087,3-glycidyloxypropyltrimethoxysilane PubChem CID: 17317 IUPAC Name: trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane SMILES: CO[Si](CCCOCC1CO1)(OC)OC
| PubChem CID | 17317 |
|---|---|
| CAS | 2530-83-8 |
| Molecular Weight (g/mol) | 236.339 |
| MDL Number | MFCD00005144 |
| SMILES | CO[Si](CCCOCC1CO1)(OC)OC |
| Synonym | 3-glycidoxypropyltrimethoxysilane,3-glycidoxypropyl trimethoxysilane,glymo,silicone kbm 403,silane a 187,union carbide a-187,silan a 187,silane z 6040,silane-y-4087,3-glycidyloxypropyltrimethoxysilane |
| IUPAC Name | trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
| InChI Key | BPSIOYPQMFLKFR-UHFFFAOYSA-N |
| Molecular Formula | C9H20O5Si |
Allyltriphenyltin 95.0+%, TCI America™
CAS: 76-63-1 Molecular Formula: C21H20Sn Molecular Weight (g/mol): 391.101 MDL Number: MFCD00048162 InChI Key: NDUYAGLANMHJHF-UHFFFAOYSA-N Synonym: Triphenylallyltin PubChem CID: 6452 IUPAC Name: triphenyl(prop-2-enyl)stannane SMILES: C=CC[Sn](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3
| PubChem CID | 6452 |
|---|---|
| CAS | 76-63-1 |
| Molecular Weight (g/mol) | 391.101 |
| MDL Number | MFCD00048162 |
| SMILES | C=CC[Sn](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
| Synonym | Triphenylallyltin |
| IUPAC Name | triphenyl(prop-2-enyl)stannane |
| InChI Key | NDUYAGLANMHJHF-UHFFFAOYSA-N |
| Molecular Formula | C21H20Sn |
Trimethoxy(methyl)silane 98.0+%, TCI America™
CAS: 1185-55-3 Molecular Formula: C4H12O3Si Molecular Weight (g/mol): 136.222 MDL Number: MFCD00008342 InChI Key: BFXIKLCIZHOAAZ-UHFFFAOYSA-N Synonym: methyltrimethoxysilane,trimethoxy methyl silane,silane, trimethoxymethyl,union carbide a-163,silane, methyltrimethoxy,methyl trimethoxysilane,silane a-163,dynasylan mtms,unii-0hi0d71mci,methyl-trimethoxysilane PubChem CID: 14456 IUPAC Name: trimethoxy(methyl)silane SMILES: CO[Si](C)(OC)OC
| PubChem CID | 14456 |
|---|---|
| CAS | 1185-55-3 |
| Molecular Weight (g/mol) | 136.222 |
| MDL Number | MFCD00008342 |
| SMILES | CO[Si](C)(OC)OC |
| Synonym | methyltrimethoxysilane,trimethoxy methyl silane,silane, trimethoxymethyl,union carbide a-163,silane, methyltrimethoxy,methyl trimethoxysilane,silane a-163,dynasylan mtms,unii-0hi0d71mci,methyl-trimethoxysilane |
| IUPAC Name | trimethoxy(methyl)silane |
| InChI Key | BFXIKLCIZHOAAZ-UHFFFAOYSA-N |
| Molecular Formula | C4H12O3Si |
Potassium Antimony Tartrate Trihydrate, ACS Reagent Grade, Ricca Chemical
CAS: 28300-74-5 Molecular Weight (g/mol): 671.9 g/mol
| CAS | 28300-74-5 |
|---|---|
| Molecular Weight (g/mol) | 671.9 g/mol |